About 2-(dimethylamino)benzoic acid;ethene
2-(dimethylamino)benzoic acid;ethene (PubChem CID 157119009) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(dimethylamino)benzoic acid;ethene.
Molecular Properties
| Compound Name | 2-(dimethylamino)benzoic acid;ethene |
| PubChem CID | 157119009 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(dimethylamino)benzoic acid;ethene |
| SMILES | C=C.CN(C)c1ccccc1C(=O)O |
| InChI | InChI=1S/C9H11NO2.C2H4/c1-10(2)8-6-4-3-5-7(8)9(11)12;1-2/h3-6H,1-2H3,(H,11,12);1-2H2 |
| InChIKey | AHSWWYHKKHJZIC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)benzoic acid;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)benzoic acid;ethene?
The IUPAC name of 2-(dimethylamino)benzoic acid;ethene (CID 157119009) is 2-(dimethylamino)benzoic acid;ethene.
What is the SMILES notation for 2-(dimethylamino)benzoic acid;ethene?
The canonical SMILES for 2-(dimethylamino)benzoic acid;ethene is C=C.CN(C)c1ccccc1C(=O)O.
What is the InChIKey of 2-(dimethylamino)benzoic acid;ethene?
The InChIKey is AHSWWYHKKHJZIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C2H4/c1-10(2)8-6-4-3-5-7(8)9(11)12;1-2/h3-6H,1-2H3,(H,11,12);1-2H2.
What are the key properties of 2-(dimethylamino)benzoic acid;ethene?
2-(dimethylamino)benzoic acid;ethene has a molecular weight of 193.25 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)benzoic acid;ethene is sourced from PubChem (CID 157119009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).