About 3,4-diethyl-1,2,5-trimethylpyrrole
3,4-diethyl-1,2,5-trimethylpyrrole (PubChem CID 15711936) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 3,4-diethyl-1,2,5-trimethylpyrrole.
Molecular Properties
| Compound Name | 3,4-diethyl-1,2,5-trimethylpyrrole |
| PubChem CID | 15711936 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 3,4-diethyl-1,2,5-trimethylpyrrole |
| SMILES | CCc1c(CC)c(C)n(C)c1C |
| InChI | InChI=1S/C11H19N/c1-6-10-8(3)12(5)9(4)11(10)7-2/h6-7H2,1-5H3 |
| InChIKey | FBZHGLAFDIPXFU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-diethyl-1,2,5-trimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethyl-1,2,5-trimethylpyrrole?
The IUPAC name of 3,4-diethyl-1,2,5-trimethylpyrrole (CID 15711936) is 3,4-diethyl-1,2,5-trimethylpyrrole.
What is the SMILES notation for 3,4-diethyl-1,2,5-trimethylpyrrole?
The canonical SMILES for 3,4-diethyl-1,2,5-trimethylpyrrole is CCc1c(CC)c(C)n(C)c1C.
What is the InChIKey of 3,4-diethyl-1,2,5-trimethylpyrrole?
The InChIKey is FBZHGLAFDIPXFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-6-10-8(3)12(5)9(4)11(10)7-2/h6-7H2,1-5H3.
What are the key properties of 3,4-diethyl-1,2,5-trimethylpyrrole?
3,4-diethyl-1,2,5-trimethylpyrrole has a molecular weight of 165.28 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethyl-1,2,5-trimethylpyrrole is sourced from PubChem (CID 15711936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).