About CID 157119570
CID 157119570 (PubChem CID 157119570) has the molecular formula C25H17N5Sn
and a molecular weight of 506.16 g/mol.
Molecular Properties
| Compound Name | CID 157119570 |
| PubChem CID | 157119570 |
| Molecular Formula | C25H17N5Sn |
| Molecular Weight | 506.16 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | — |
| SMILES | C1=Cc2cc3ccc(cc4cc(-c5ccccn5)c(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[Sn] |
| InChI | InChI=1S/C25H17N5.Sn/c1-2-10-26-24(3-1)23-14-22-13-20-7-6-18(28-20)11-16-4-5-17(27-16)12-19-8-9-21(29-19)15-25(23)30-22;/h1-15,28,30H;/b16-11-,17-12-,18-11-,19-12-,20-13-,21-15-,22-13-,25-15-; |
| InChIKey | STLPJTZRMDXXOY-FKXAVMLUSA-N |
| XLogP | 5.34 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.16 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 157119570 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157119570?
The IUPAC name of CID 157119570 (CID 157119570) is not available.
What is the SMILES notation for CID 157119570?
The canonical SMILES for CID 157119570 is C1=Cc2cc3ccc(cc4cc(-c5ccccn5)c(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[Sn].
What is the InChIKey of CID 157119570?
The InChIKey is STLPJTZRMDXXOY-FKXAVMLUSA-N. The full InChI is InChI=1S/C25H17N5.Sn/c1-2-10-26-24(3-1)23-14-22-13-20-7-6-18(28-20)11-16-4-5-17(27-16)12-19-8-9-21(29-19)15-25(23)30-22;/h1-15,28,30H;/b16-11-,17-12-,18-11-,19-12-,20-13-,21-15-,22-13-,25-15-;.
What are the key properties of CID 157119570?
CID 157119570 has a molecular weight of 506.16 g/mol, XLogP of 5.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157119570 is sourced from PubChem (CID 157119570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).