About 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline
3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline (PubChem CID 157119689) has the molecular formula C20H29N3
and a molecular weight of 311.47 g/mol. Its IUPAC name is 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline.
Molecular Properties
| Compound Name | 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline |
| PubChem CID | 157119689 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C(C)c2ccc(CN)cc2)c(CN)c1 |
| InChI | InChI=1S/C20H29N3/c1-4-23(5-2)19-10-11-20(18(12-19)14-22)15(3)17-8-6-16(13-21)7-9-17/h6-12,15H,4-5,13-14,21-22H2,1-3H3 |
| InChIKey | AHUZXGOLSANQJB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline?
The IUPAC name of 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline (CID 157119689) is 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline.
What is the SMILES notation for 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline?
The canonical SMILES for 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline is CCN(CC)c1ccc(C(C)c2ccc(CN)cc2)c(CN)c1.
What is the InChIKey of 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline?
The InChIKey is AHUZXGOLSANQJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3/c1-4-23(5-2)19-10-11-20(18(12-19)14-22)15(3)17-8-6-16(13-21)7-9-17/h6-12,15H,4-5,13-14,21-22H2,1-3H3.
What are the key properties of 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline?
3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline has a molecular weight of 311.47 g/mol, XLogP of 3.60, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-4-[1-[4-(aminomethyl)phenyl]ethyl]-N,N-diethylaniline is sourced from PubChem (CID 157119689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).