C13H14BrNO2 — CID 15711973
1-(6-bromo-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]quinolin-3-yl)ethanone (PubChem CID 15711973) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is 1-(6-bromo-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]quinolin-3-yl)ethanone.
| Compound Name | 1-(6-bromo-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]quinolin-3-yl)ethanone |
|---|---|
| PubChem CID | 15711973 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 1-(6-bromo-2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]quinolin-3-yl)ethanone |
| SMILES | CC(=O)N1c2ccc(Br)cc2C2OC2C1(C)C |
| InChI | InChI=1S/C13H14BrNO2/c1-7(16)15-10-5-4-8(14)6-9(10)11-12(17-11)13(15,2)3/h4-6,11-12H,1-3H3 |
| InChIKey | IKPKMPPBXAPWDX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|