About (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine
(4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine (PubChem CID 15712021) has the molecular formula C15H21NSi
and a molecular weight of 243.43 g/mol. Its IUPAC name is (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine.
Molecular Properties
| Compound Name | (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine |
| PubChem CID | 15712021 |
| Molecular Formula | C15H21NSi |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine |
| SMILES | C/C=C/CC(=C=Nc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C15H21NSi/c1-5-6-12-15(17(2,3)4)13-16-14-10-8-7-9-11-14/h5-11H,12H2,1-4H3/b6-5+ |
| InChIKey | KKPLXRJLJRULHO-AATRIKPKSA-N |
| XLogP | 4.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine?
The IUPAC name of (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine (CID 15712021) is (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine.
What is the SMILES notation for (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine?
The canonical SMILES for (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine is C/C=C/CC(=C=Nc1ccccc1)[Si](C)(C)C.
What is the InChIKey of (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine?
The InChIKey is KKPLXRJLJRULHO-AATRIKPKSA-N. The full InChI is InChI=1S/C15H21NSi/c1-5-6-12-15(17(2,3)4)13-16-14-10-8-7-9-11-14/h5-11H,12H2,1-4H3/b6-5+.
What are the key properties of (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine?
(4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine has a molecular weight of 243.43 g/mol, XLogP of 4.76, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-N-phenyl-2-trimethylsilylhexa-1,4-dien-1-imine is sourced from PubChem (CID 15712021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).