C22H24N9O8S3- — CID 157121108
1-N-[(3R,3aR,6S,6aR)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-(2-amino-1,3-benzothiazol-4-yl)-3-(2H-tetrazol-5-yl)benzene-1,2-disulfonamide acetate (PubChem CID 157121108) has the molecular formula C22H24N9O8S3- and a molecular weight of 638.69 g/mol. Its IUPAC name is 1-N-[(3R,3aR,6S,6aR)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-(2-amino-1,3-benzothiazol-4-yl)-3-(2H-tetrazol-5-yl)benzene-1,2-disulfonamide acetate.
| Compound Name | 1-N-[(3R,3aR,6S,6aR)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-(2-amino-1,3-benzothiazol-4-yl)-3-(2H-tetrazol-5-yl)benzene-1,2-disulfonamide acetate |
|---|---|
| PubChem CID | 157121108 |
| Molecular Formula | C22H24N9O8S3- |
| Molecular Weight | 638.69 g/mol |
| Exact Mass | 638.09 |
| IUPAC Name | 1-N-[(3R,3aR,6S,6aR)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-(2-amino-1,3-benzothiazol-4-yl)-3-(2H-tetrazol-5-yl)benzene-1,2-disulfonamide acetate |
| SMILES | CC(=O)[O-].Nc1nc2c(-c3ccc(S(=O)(=O)N[C@H]4CO[C@H]5[C@@H]4OC[C@H]5N)c(S(N)(=O)=O)c3-c3nn[nH]n3)cccc2s1 |
| InChI | InChI=1S/C20H21N9O6S3.C2H4O2/c21-10-6-34-17-11(7-35-16(10)17)27-38(32,33)13-5-4-8(9-2-1-3-12-15(9)24-20(22)36-12)14(18(13)37(23,30)31)19-25-28-29-26-19;1-2(3)4/h1-5,10-11,16-17,27H,6-7,21H2,(H2,22,24)(H2,23,30,31)(H,25,26,28,29);1H3,(H,3,4)/p-1/t10-,11+,16-,17-;/m1./s1 |
| InChIKey | GNOPXAGBZMKOCA-FUFUNWMWSA-M |
| XLogP | -2.10 |
| TPSA | 284.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.69 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |