2-(1,2,4-triazol-1-yl)benzoic acid

C9H7N3O2 — CID 15712146

IUPAC2-(1,2,4-triazol-1-yl)benzoic acid
SMILESO=C(O)c1ccccc1-n1cncn1
InChIInChI=1S/C9H7N3O2/c13-9(14)7-3-1-2-4-8(7)12-6-10-5-11-12/h1-6H,(H,13,14)
InChIKeyINJKHFHZWYNONQ-UHFFFAOYSA-N
MW189.17 g/mol
LogP0.97
Rot. Bonds2

About 2-(1,2,4-triazol-1-yl)benzoic acid

2-(1,2,4-triazol-1-yl)benzoic acid (PubChem CID 15712146) has the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)benzoic acid.

Molecular Properties

Compound Name2-(1,2,4-triazol-1-yl)benzoic acid
PubChem CID15712146
Molecular FormulaC9H7N3O2
Molecular Weight189.17 g/mol
Exact Mass189.05
IUPAC Name2-(1,2,4-triazol-1-yl)benzoic acid
SMILESO=C(O)c1ccccc1-n1cncn1
InChIInChI=1S/C9H7N3O2/c13-9(14)7-3-1-2-4-8(7)12-6-10-5-11-12/h1-6H,(H,13,14)
InChIKeyINJKHFHZWYNONQ-UHFFFAOYSA-N
XLogP0.97
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.17
LogP ≤ 50.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1,2,4-triazol-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2,4-triazol-1-yl)benzoic acid?
The IUPAC name of 2-(1,2,4-triazol-1-yl)benzoic acid (CID 15712146) is 2-(1,2,4-triazol-1-yl)benzoic acid.
What is the SMILES notation for 2-(1,2,4-triazol-1-yl)benzoic acid?
The canonical SMILES for 2-(1,2,4-triazol-1-yl)benzoic acid is O=C(O)c1ccccc1-n1cncn1.
What is the InChIKey of 2-(1,2,4-triazol-1-yl)benzoic acid?
The InChIKey is INJKHFHZWYNONQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2/c13-9(14)7-3-1-2-4-8(7)12-6-10-5-11-12/h1-6H,(H,13,14).
What are the key properties of 2-(1,2,4-triazol-1-yl)benzoic acid?
2-(1,2,4-triazol-1-yl)benzoic acid has a molecular weight of 189.17 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-triazol-1-yl)benzoic acid is sourced from PubChem (CID 15712146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).