About N-(3-methoxyphenyl)-2,4,6-trimethylaniline
N-(3-methoxyphenyl)-2,4,6-trimethylaniline (PubChem CID 15712171) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2,4,6-trimethylaniline.
Molecular Properties
| Compound Name | N-(3-methoxyphenyl)-2,4,6-trimethylaniline |
| PubChem CID | 15712171 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-(3-methoxyphenyl)-2,4,6-trimethylaniline |
| SMILES | COc1cccc(Nc2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C16H19NO/c1-11-8-12(2)16(13(3)9-11)17-14-6-5-7-15(10-14)18-4/h5-10,17H,1-4H3 |
| InChIKey | VFCZKTCPEPGZED-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-methoxyphenyl)-2,4,6-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxyphenyl)-2,4,6-trimethylaniline?
The IUPAC name of N-(3-methoxyphenyl)-2,4,6-trimethylaniline (CID 15712171) is N-(3-methoxyphenyl)-2,4,6-trimethylaniline.
What is the SMILES notation for N-(3-methoxyphenyl)-2,4,6-trimethylaniline?
The canonical SMILES for N-(3-methoxyphenyl)-2,4,6-trimethylaniline is COc1cccc(Nc2c(C)cc(C)cc2C)c1.
What is the InChIKey of N-(3-methoxyphenyl)-2,4,6-trimethylaniline?
The InChIKey is VFCZKTCPEPGZED-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO/c1-11-8-12(2)16(13(3)9-11)17-14-6-5-7-15(10-14)18-4/h5-10,17H,1-4H3.
What are the key properties of N-(3-methoxyphenyl)-2,4,6-trimethylaniline?
N-(3-methoxyphenyl)-2,4,6-trimethylaniline has a molecular weight of 241.33 g/mol, XLogP of 4.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxyphenyl)-2,4,6-trimethylaniline is sourced from PubChem (CID 15712171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).