About 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine
4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine (PubChem CID 157123069) has the molecular formula C12H27N3O2
and a molecular weight of 245.37 g/mol. Its IUPAC name is 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine.
Molecular Properties
| Compound Name | 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine |
| PubChem CID | 157123069 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine |
| SMILES | NCC1(N)CCOCC1.NCC1CCOCC1 |
| InChI | InChI=1S/C6H14N2O.C6H13NO/c7-5-6(8)1-3-9-4-2-6;7-5-6-1-3-8-4-2-6/h1-5,7-8H2;6H,1-5,7H2 |
| InChIKey | AIEWJKKWLDGWMD-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine?
The IUPAC name of 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine (CID 157123069) is 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine.
What is the SMILES notation for 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine?
The canonical SMILES for 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine is NCC1(N)CCOCC1.NCC1CCOCC1.
What is the InChIKey of 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine?
The InChIKey is AIEWJKKWLDGWMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.C6H13NO/c7-5-6(8)1-3-9-4-2-6;7-5-6-1-3-8-4-2-6/h1-5,7-8H2;6H,1-5,7H2.
What are the key properties of 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine?
4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine has a molecular weight of 245.37 g/mol, XLogP of -0.18, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)oxan-4-amine;oxan-4-ylmethanamine is sourced from PubChem (CID 157123069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).