About 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane
3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane (PubChem CID 157123152) has the molecular formula C19H12BBr3Cl4N2O2
and a molecular weight of 692.65 g/mol. Its IUPAC name is 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane.
Molecular Properties
| Compound Name | 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane |
| PubChem CID | 157123152 |
| Molecular Formula | C19H12BBr3Cl4N2O2 |
| Molecular Weight | 692.65 g/mol |
| Exact Mass | 687.73 |
| IUPAC Name | 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane |
| SMILES | BrB(Br)Br.COc1cc2ncc(Cl)cc2cc1Cl.Oc1cc2ncc(Cl)cc2cc1Cl |
| InChI | InChI=1S/C10H7Cl2NO.C9H5Cl2NO.BBr3/c1-14-10-4-9-6(3-8(10)12)2-7(11)5-13-9;10-6-1-5-2-7(11)9(13)3-8(5)12-4-6;2-1(3)4/h2-5H,1H3;1-4,13H; |
| InChIKey | AIFDTVHRFNUNBW-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 692.65 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane?
The IUPAC name of 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane (CID 157123152) is 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane.
What is the SMILES notation for 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane?
The canonical SMILES for 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane is BrB(Br)Br.COc1cc2ncc(Cl)cc2cc1Cl.Oc1cc2ncc(Cl)cc2cc1Cl.
What is the InChIKey of 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane?
The InChIKey is AIFDTVHRFNUNBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2NO.C9H5Cl2NO.BBr3/c1-14-10-4-9-6(3-8(10)12)2-7(11)5-13-9;10-6-1-5-2-7(11)9(13)3-8(5)12-4-6;2-1(3)4/h2-5H,1H3;1-4,13H;.
What are the key properties of 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane?
3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane has a molecular weight of 692.65 g/mol, XLogP of 8.95, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-7-methoxyquinoline;3,6-dichloroquinolin-7-ol;tribromoborane is sourced from PubChem (CID 157123152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).