C20H19ClN2O4S — CID 157123200
1-[(2S)-1-(1-benzofuran-2-ylsulfonyl)pyrrolidin-2-yl]-3-(2-chloro-4-pyridinyl)propan-1-one (PubChem CID 157123200) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is 1-[(2S)-1-(1-benzofuran-2-ylsulfonyl)pyrrolidin-2-yl]-3-(2-chloro-4-pyridinyl)propan-1-one.
| Compound Name | 1-[(2S)-1-(1-benzofuran-2-ylsulfonyl)pyrrolidin-2-yl]-3-(2-chloro-4-pyridinyl)propan-1-one |
|---|---|
| PubChem CID | 157123200 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 1-[(2S)-1-(1-benzofuran-2-ylsulfonyl)pyrrolidin-2-yl]-3-(2-chloro-4-pyridinyl)propan-1-one |
| SMILES | O=C(CCc1ccnc(Cl)c1)[C@@H]1CCCN1S(=O)(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H19ClN2O4S/c21-19-12-14(9-10-22-19)7-8-17(24)16-5-3-11-23(16)28(25,26)20-13-15-4-1-2-6-18(15)27-20/h1-2,4,6,9-10,12-13,16H,3,5,7-8,11H2/t16-/m0/s1 |
| InChIKey | AIFIHGWJRLHJBB-INIZCTEOSA-N |
| XLogP | 3.84 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|