About sodium;dimethylphosphinate;phosphoryl trichloride
sodium;dimethylphosphinate;phosphoryl trichloride (PubChem CID 157123348) has the molecular formula C2H6Cl3NaO3P2
and a molecular weight of 269.36 g/mol. Its IUPAC name is sodium;dimethylphosphinate;phosphoryl trichloride.
Molecular Properties
| Compound Name | sodium;dimethylphosphinate;phosphoryl trichloride |
| PubChem CID | 157123348 |
| Molecular Formula | C2H6Cl3NaO3P2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 267.88 |
| IUPAC Name | sodium;dimethylphosphinate;phosphoryl trichloride |
| SMILES | CP(C)(=O)[O-].O=P(Cl)(Cl)Cl.[Na+] |
| InChI | InChI=1S/C2H7O2P.Cl3OP.Na/c2*1-5(2,3)4;/h1-2H3,(H,3,4);;/q;;+1/p-1 |
| InChIKey | MSBKIWPDFXFWCW-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;dimethylphosphinate;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;dimethylphosphinate;phosphoryl trichloride?
The IUPAC name of sodium;dimethylphosphinate;phosphoryl trichloride (CID 157123348) is sodium;dimethylphosphinate;phosphoryl trichloride.
What is the SMILES notation for sodium;dimethylphosphinate;phosphoryl trichloride?
The canonical SMILES for sodium;dimethylphosphinate;phosphoryl trichloride is CP(C)(=O)[O-].O=P(Cl)(Cl)Cl.[Na+].
What is the InChIKey of sodium;dimethylphosphinate;phosphoryl trichloride?
The InChIKey is MSBKIWPDFXFWCW-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H7O2P.Cl3OP.Na/c2*1-5(2,3)4;/h1-2H3,(H,3,4);;/q;;+1/p-1.
What are the key properties of sodium;dimethylphosphinate;phosphoryl trichloride?
sodium;dimethylphosphinate;phosphoryl trichloride has a molecular weight of 269.36 g/mol, XLogP of -0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;dimethylphosphinate;phosphoryl trichloride is sourced from PubChem (CID 157123348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).