C41H45BrN2O2 — CID 157123404
4-[dibenzofuran-2-carbonyl(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide (PubChem CID 157123404) has the molecular formula C41H45BrN2O2 and a molecular weight of 677.73 g/mol. Its IUPAC name is 4-[dibenzofuran-2-carbonyl(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide.
| Compound Name | 4-[dibenzofuran-2-carbonyl(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
|---|---|
| PubChem CID | 157123404 |
| Molecular Formula | C41H45BrN2O2 |
| Molecular Weight | 677.73 g/mol |
| Exact Mass | 676.27 |
| IUPAC Name | 4-[dibenzofuran-2-carbonyl(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
| SMILES | CC[N+](CC)(CCCCN(Cc1ccc2ccccc2c1)C(=O)c1ccc2oc3ccccc3c2c1)Cc1cc(C)cc(C)c1.[Br-] |
| InChI | InChI=1S/C41H45N2O2.BrH/c1-5-43(6-2,29-33-24-30(3)23-31(4)25-33)22-12-11-21-42(28-32-17-18-34-13-7-8-14-35(34)26-32)41(44)36-19-20-40-38(27-36)37-15-9-10-16-39(37)45-40;/h7-10,13-20,23-27H,5-6,11-12,21-22,28-29H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | DJWKFVIXBQCSLO-UHFFFAOYSA-M |
| XLogP | 6.84 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.73 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|