C27H22N4S2 — CID 157123726
2-benzylsulfanyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2-thione (PubChem CID 157123726) has the molecular formula C27H22N4S2 and a molecular weight of 466.64 g/mol. Its IUPAC name is 2-benzylsulfanyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2-thione.
| Compound Name | 2-benzylsulfanyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2-thione |
|---|---|
| PubChem CID | 157123726 |
| Molecular Formula | C27H22N4S2 |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-benzylsulfanyl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12),9-pentaene;1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2-thione |
| SMILES | C1=Cc2cccc3nc(SCc4ccccc4)n(c23)C1.S=c1[nH]c2cccc3c2n1CC=C3 |
| InChI | InChI=1S/C17H14N2S.C10H8N2S/c1-2-6-13(7-3-1)12-20-17-18-15-10-4-8-14-9-5-11-19(17)16(14)15;13-10-11-8-5-1-3-7-4-2-6-12(10)9(7)8/h1-10H,11-12H2;1-5H,6H2,(H,11,13) |
| InChIKey | AIGUOONVPYITSC-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|