C20H35NO6 — CID 15712428
propan-2-yl (2R,3S)-2-acetyloxy-4-cyclohexyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 15712428) has the molecular formula C20H35NO6 and a molecular weight of 385.50 g/mol. Its IUPAC name is propan-2-yl (2R,3S)-2-acetyloxy-4-cyclohexyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | propan-2-yl (2R,3S)-2-acetyloxy-4-cyclohexyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 15712428 |
| Molecular Formula | C20H35NO6 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | propan-2-yl (2R,3S)-2-acetyloxy-4-cyclohexyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(=O)O[C@@H](C(=O)OC(C)C)[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H35NO6/c1-13(2)25-18(23)17(26-14(3)22)16(12-15-10-8-7-9-11-15)21-19(24)27-20(4,5)6/h13,15-17H,7-12H2,1-6H3,(H,21,24)/t16-,17+/m0/s1 |
| InChIKey | OFJRHPJPRFDQSH-DLBZAZTESA-N |
| XLogP | 3.73 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|