C39H60O3 — CID 157125557
6-[(5,8-dimethyl-4-oxo-2,3-dihydro-1H-naphthalen-2-yl)methyl]-5-ethylnonane-2,4-dione;1,2,3,4,5,6-hexamethylbenzene;propane (PubChem CID 157125557) has the molecular formula C39H60O3 and a molecular weight of 576.91 g/mol. Its IUPAC name is 6-[(5,8-dimethyl-4-oxo-2,3-dihydro-1H-naphthalen-2-yl)methyl]-5-ethylnonane-2,4-dione;1,2,3,4,5,6-hexamethylbenzene;propane.
| Compound Name | 6-[(5,8-dimethyl-4-oxo-2,3-dihydro-1H-naphthalen-2-yl)methyl]-5-ethylnonane-2,4-dione;1,2,3,4,5,6-hexamethylbenzene;propane |
|---|---|
| PubChem CID | 157125557 |
| Molecular Formula | C39H60O3 |
| Molecular Weight | 576.91 g/mol |
| Exact Mass | 576.45 |
| IUPAC Name | 6-[(5,8-dimethyl-4-oxo-2,3-dihydro-1H-naphthalen-2-yl)methyl]-5-ethylnonane-2,4-dione;1,2,3,4,5,6-hexamethylbenzene;propane |
| SMILES | CCC.CCCC(CC1CC(=O)c2c(C)ccc(C)c2C1)C(CC)C(=O)CC(C)=O.Cc1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C24H34O3.C12H18.C3H8/c1-6-8-19(20(7-2)22(26)11-17(5)25)12-18-13-21-15(3)9-10-16(4)24(21)23(27)14-18;1-7-8(2)10(4)12(6)11(5)9(7)3;1-3-2/h9-10,18-20H,6-8,11-14H2,1-5H3;1-6H3;3H2,1-2H3 |
| InChIKey | AILUNRBJURKKGC-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.91 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|