C17H26N2O2 — CID 157126140
(3aR,7aS)-3a,4,7,7a-tetrahydroisoindole-1,3-dione;2,3,3a,4,7,7a-hexahydro-1H-isoindole;methane (PubChem CID 157126140) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (3aR,7aS)-3a,4,7,7a-tetrahydroisoindole-1,3-dione;2,3,3a,4,7,7a-hexahydro-1H-isoindole;methane.
| Compound Name | (3aR,7aS)-3a,4,7,7a-tetrahydroisoindole-1,3-dione;2,3,3a,4,7,7a-hexahydro-1H-isoindole;methane |
|---|---|
| PubChem CID | 157126140 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (3aR,7aS)-3a,4,7,7a-tetrahydroisoindole-1,3-dione;2,3,3a,4,7,7a-hexahydro-1H-isoindole;methane |
| SMILES | C.C1=CCC2CNCC2C1.O=C1NC(=O)[C@@H]2CC=CC[C@H]12 |
| InChI | InChI=1S/C8H9NO2.C8H13N.CH4/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-2-4-8-6-9-5-7(8)3-1;/h1-2,5-6H,3-4H2,(H,9,10,11);1-2,7-9H,3-6H2;1H4/t5-,6+;; |
| InChIKey | AINIICVUSLJYMV-RUTFAPCESA-N |
| XLogP | 2.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|