About methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid
methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid (PubChem CID 157127007) has the molecular formula C9H18O5
and a molecular weight of 206.24 g/mol. Its IUPAC name is methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid |
| PubChem CID | 157127007 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid |
| SMILES | C.C.COCCOC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C7H10O5.2CH4/c1-11-4-5-12-7(10)3-2-6(8)9;;/h2-3H,4-5H2,1H3,(H,8,9);2*1H4/b3-2+;; |
| InChIKey | AIPUITVJQUVJRE-WTVBWJGASA-N |
| XLogP | 1.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid?
The IUPAC name of methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid (CID 157127007) is methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid.
What is the SMILES notation for methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid?
The canonical SMILES for methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid is C.C.COCCOC(=O)/C=C/C(=O)O.
What is the InChIKey of methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid?
The InChIKey is AIPUITVJQUVJRE-WTVBWJGASA-N. The full InChI is InChI=1S/C7H10O5.2CH4/c1-11-4-5-12-7(10)3-2-6(8)9;;/h2-3H,4-5H2,1H3,(H,8,9);2*1H4/b3-2+;;.
What are the key properties of methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid?
methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid has a molecular weight of 206.24 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(E)-4-(2-methoxyethoxy)-4-oxobut-2-enoic acid is sourced from PubChem (CID 157127007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).