C24H29NO2 — CID 15712748
(2S)-1-(2-benzyl-6-phenylhexanoyl)pyrrolidine-2-carbaldehyde (PubChem CID 15712748) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (2S)-1-(2-benzyl-6-phenylhexanoyl)pyrrolidine-2-carbaldehyde.
| Compound Name | (2S)-1-(2-benzyl-6-phenylhexanoyl)pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 15712748 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (2S)-1-(2-benzyl-6-phenylhexanoyl)pyrrolidine-2-carbaldehyde |
| SMILES | O=C[C@@H]1CCCN1C(=O)C(CCCCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c26-19-23-16-9-17-25(23)24(27)22(18-21-13-5-2-6-14-21)15-8-7-12-20-10-3-1-4-11-20/h1-6,10-11,13-14,19,22-23H,7-9,12,15-18H2/t22?,23-/m0/s1 |
| InChIKey | LGEGJQCRYDXPQU-WCSIJFPASA-N |
| XLogP | 4.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|