C11H16N6 — CID 157128091
2-N-methyl-2-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 157128091) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is 2-N-methyl-2-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-methyl-2-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 157128091 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-N-methyl-2-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC1=C(CN(C)c2nc(N)nc(N)n2)C=CC1 |
| InChI | InChI=1S/C11H16N6/c1-7-4-3-5-8(7)6-17(2)11-15-9(12)14-10(13)16-11/h3,5H,4,6H2,1-2H3,(H4,12,13,14,15,16) |
| InChIKey | TWELMTLNSFJFBI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |