C12H18N6 — CID 157128092
2-N,2-N-dimethyl-4-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 157128092) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-dimethyl-4-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 157128092 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-N,2-N-dimethyl-4-N-[(2-methylcyclopenta-1,4-dien-1-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC1=C(CNc2nc(N)nc(N(C)C)n2)C=CC1 |
| InChI | InChI=1S/C12H18N6/c1-8-5-4-6-9(8)7-14-11-15-10(13)16-12(17-11)18(2)3/h4,6H,5,7H2,1-3H3,(H3,13,14,15,16,17) |
| InChIKey | PZUPFEINALHCRV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |