C17H21NO6 — CID 157128744
1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;(2S)-2-hydroxybutanedioic acid (PubChem CID 157128744) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;(2S)-2-hydroxybutanedioic acid.
| Compound Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;(2S)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 157128744 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;(2S)-2-hydroxybutanedioic acid |
| SMILES | O=C(O)C[C@H](O)C(=O)O.OC1CCC2NC=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H15NO.C4H6O5/c15-10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-14-13;5-2(4(8)9)1-3(6)7/h1-4,8,10,13-15H,5-7H2;2,5H,1H2,(H,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | AIUOYWCFAOZGJQ-WNQIDUERSA-N |
| XLogP | -1.00 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |