About 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile
2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile (PubChem CID 15712919) has the molecular formula C10H6ClF2NO2
and a molecular weight of 245.61 g/mol. Its IUPAC name is 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile.
Molecular Properties
| Compound Name | 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile |
| PubChem CID | 15712919 |
| Molecular Formula | C10H6ClF2NO2 |
| Molecular Weight | 245.61 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile |
| SMILES | N#CC(Cl)Cc1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C10H6ClF2NO2/c11-7(5-14)4-6-2-1-3-8-9(6)16-10(12,13)15-8/h1-3,7H,4H2 |
| InChIKey | LEXOLJXWKHLXDY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile?
The IUPAC name of 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile (CID 15712919) is 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile.
What is the SMILES notation for 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile?
The canonical SMILES for 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile is N#CC(Cl)Cc1cccc2c1OC(F)(F)O2.
What is the InChIKey of 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile?
The InChIKey is LEXOLJXWKHLXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClF2NO2/c11-7(5-14)4-6-2-1-3-8-9(6)16-10(12,13)15-8/h1-3,7H,4H2.
What are the key properties of 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile?
2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile has a molecular weight of 245.61 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-(2,2-difluoro-1,3-benzodioxol-4-yl)propanenitrile is sourced from PubChem (CID 15712919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).