C20H19N5O4S — CID 157129575
N-[4-[2-[3-amino-6-(3-aminophenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide (PubChem CID 157129575) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is N-[4-[2-[3-amino-6-(3-aminophenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[2-[3-amino-6-(3-aminophenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 157129575 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-[4-[2-[3-amino-6-(3-aminophenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(CC(=O)c2nc(-c3cccc(N)c3)cnc2N)cc1 |
| InChI | InChI=1S/C20H19N5O4S/c1-12(26)25-30(28,29)16-7-5-13(6-8-16)9-18(27)19-20(22)23-11-17(24-19)14-3-2-4-15(21)10-14/h2-8,10-11H,9,21H2,1H3,(H2,22,23)(H,25,26) |
| InChIKey | BHIAHEUPSSEBMO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|