C20H19N5O6S2 — CID 157129576
N-[4-[2-[3-amino-6-(4-sulfamoylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide (PubChem CID 157129576) has the molecular formula C20H19N5O6S2 and a molecular weight of 489.54 g/mol. Its IUPAC name is N-[4-[2-[3-amino-6-(4-sulfamoylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[2-[3-amino-6-(4-sulfamoylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 157129576 |
| Molecular Formula | C20H19N5O6S2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | N-[4-[2-[3-amino-6-(4-sulfamoylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(CC(=O)c2nc(-c3ccc(S(N)(=O)=O)cc3)cnc2N)cc1 |
| InChI | InChI=1S/C20H19N5O6S2/c1-12(26)25-33(30,31)16-6-2-13(3-7-16)10-18(27)19-20(21)23-11-17(24-19)14-4-8-15(9-5-14)32(22,28)29/h2-9,11H,10H2,1H3,(H2,21,23)(H,25,26)(H2,22,28,29) |
| InChIKey | OUWPFDGUUGPQSG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 192.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |