C27H19Cl4FN4O6 — CID 157130067
2-chloropyridine-3-carbonyl chloride;2-chloropyridine-3-carboxylic acid;ethyl 3-[(2-chloropyridine-3-carbonyl)amino]-5-fluorobenzoate (PubChem CID 157130067) has the molecular formula C27H19Cl4FN4O6 and a molecular weight of 656.28 g/mol. Its IUPAC name is 2-chloropyridine-3-carbonyl chloride;2-chloropyridine-3-carboxylic acid;ethyl 3-[(2-chloropyridine-3-carbonyl)amino]-5-fluorobenzoate.
| Compound Name | 2-chloropyridine-3-carbonyl chloride;2-chloropyridine-3-carboxylic acid;ethyl 3-[(2-chloropyridine-3-carbonyl)amino]-5-fluorobenzoate |
|---|---|
| PubChem CID | 157130067 |
| Molecular Formula | C27H19Cl4FN4O6 |
| Molecular Weight | 656.28 g/mol |
| Exact Mass | 654.00 |
| IUPAC Name | 2-chloropyridine-3-carbonyl chloride;2-chloropyridine-3-carboxylic acid;ethyl 3-[(2-chloropyridine-3-carbonyl)amino]-5-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(F)cc(NC(=O)c2cccnc2Cl)c1.O=C(Cl)c1cccnc1Cl.O=C(O)c1cccnc1Cl |
| InChI | InChI=1S/C15H12ClFN2O3.C6H3Cl2NO.C6H4ClNO2/c1-2-22-15(21)9-6-10(17)8-11(7-9)19-14(20)12-4-3-5-18-13(12)16;7-5-4(6(8)10)2-1-3-9-5;7-5-4(6(9)10)2-1-3-8-5/h3-8H,2H2,1H3,(H,19,20);1-3H;1-3H,(H,9,10) |
| InChIKey | AIYRMXWEBKBAFX-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.28 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|