About 3-ethyl-3-methyloxolane-2,5-dione;methane
3-ethyl-3-methyloxolane-2,5-dione;methane (PubChem CID 157130864) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-ethyl-3-methyloxolane-2,5-dione;methane.
Molecular Properties
| Compound Name | 3-ethyl-3-methyloxolane-2,5-dione;methane |
| PubChem CID | 157130864 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 3-ethyl-3-methyloxolane-2,5-dione;methane |
| SMILES | C.CCC1(C)CC(=O)OC1=O |
| InChI | InChI=1S/C7H10O3.CH4/c1-3-7(2)4-5(8)10-6(7)9;/h3-4H2,1-2H3;1H4 |
| InChIKey | AJBDSMNIPHARBX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-3-methyloxolane-2,5-dione;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-methyloxolane-2,5-dione;methane?
The IUPAC name of 3-ethyl-3-methyloxolane-2,5-dione;methane (CID 157130864) is 3-ethyl-3-methyloxolane-2,5-dione;methane.
What is the SMILES notation for 3-ethyl-3-methyloxolane-2,5-dione;methane?
The canonical SMILES for 3-ethyl-3-methyloxolane-2,5-dione;methane is C.CCC1(C)CC(=O)OC1=O.
What is the InChIKey of 3-ethyl-3-methyloxolane-2,5-dione;methane?
The InChIKey is AJBDSMNIPHARBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.CH4/c1-3-7(2)4-5(8)10-6(7)9;/h3-4H2,1-2H3;1H4.
What are the key properties of 3-ethyl-3-methyloxolane-2,5-dione;methane?
3-ethyl-3-methyloxolane-2,5-dione;methane has a molecular weight of 158.20 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-methyloxolane-2,5-dione;methane is sourced from PubChem (CID 157130864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).