C45H33F3O4S2 — CID 157132043
1-[4-[2-(4-ethyl-9H-fluoren-1-yl)phenyl]sulfonylphenyl]pyrene;trifluoro(methylsulfonyl)methane (PubChem CID 157132043) has the molecular formula C45H33F3O4S2 and a molecular weight of 758.88 g/mol. Its IUPAC name is 1-[4-[2-(4-ethyl-9H-fluoren-1-yl)phenyl]sulfonylphenyl]pyrene;trifluoro(methylsulfonyl)methane.
| Compound Name | 1-[4-[2-(4-ethyl-9H-fluoren-1-yl)phenyl]sulfonylphenyl]pyrene;trifluoro(methylsulfonyl)methane |
|---|---|
| PubChem CID | 157132043 |
| Molecular Formula | C45H33F3O4S2 |
| Molecular Weight | 758.88 g/mol |
| Exact Mass | 758.18 |
| IUPAC Name | 1-[4-[2-(4-ethyl-9H-fluoren-1-yl)phenyl]sulfonylphenyl]pyrene;trifluoro(methylsulfonyl)methane |
| SMILES | CCc1ccc(-c2ccccc2S(=O)(=O)c2ccc(-c3ccc4ccc5cccc6ccc3c4c56)cc2)c2c1-c1ccccc1C2.CS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C43H30O2S.C2H3F3O2S/c1-2-27-18-24-36(39-26-32-8-3-4-11-35(32)42(27)39)37-12-5-6-13-40(37)46(44,45)33-21-16-28(17-22-33)34-23-19-31-15-14-29-9-7-10-30-20-25-38(34)43(31)41(29)30;1-8(6,7)2(3,4)5/h3-25H,2,26H2,1H3;1H3 |
| InChIKey | AJEMDBHVNIYQLK-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.88 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|