C25H36N4O — CID 157132633
ethane;5-methyl-1H-indazole;5-methyl-1-(oxan-2-yl)indazole (PubChem CID 157132633) has the molecular formula C25H36N4O and a molecular weight of 408.59 g/mol. Its IUPAC name is ethane;5-methyl-1H-indazole;5-methyl-1-(oxan-2-yl)indazole.
| Compound Name | ethane;5-methyl-1H-indazole;5-methyl-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 157132633 |
| Molecular Formula | C25H36N4O |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | ethane;5-methyl-1H-indazole;5-methyl-1-(oxan-2-yl)indazole |
| SMILES | CC.CC.Cc1ccc2[nH]ncc2c1.Cc1ccc2c(cnn2C2CCCCO2)c1 |
| InChI | InChI=1S/C13H16N2O.C8H8N2.2C2H6/c1-10-5-6-12-11(8-10)9-14-15(12)13-4-2-3-7-16-13;1-6-2-3-8-7(4-6)5-9-10-8;2*1-2/h5-6,8-9,13H,2-4,7H2,1H3;2-5H,1H3,(H,9,10);2*1-2H3 |
| InChIKey | AJGFNSLYJUMTLW-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |