C27H32ClN3O2 — CID 157132761
(1S)-1-[4-(4-chlorophenyl)-1-(3-isocyanopropyl)-2,3,6-trimethylpyrrolo[2,3-b]pyridin-5-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one (PubChem CID 157132761) has the molecular formula C27H32ClN3O2 and a molecular weight of 466.03 g/mol. Its IUPAC name is (1S)-1-[4-(4-chlorophenyl)-1-(3-isocyanopropyl)-2,3,6-trimethylpyrrolo[2,3-b]pyridin-5-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one.
| Compound Name | (1S)-1-[4-(4-chlorophenyl)-1-(3-isocyanopropyl)-2,3,6-trimethylpyrrolo[2,3-b]pyridin-5-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one |
|---|---|
| PubChem CID | 157132761 |
| Molecular Formula | C27H32ClN3O2 |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (1S)-1-[4-(4-chlorophenyl)-1-(3-isocyanopropyl)-2,3,6-trimethylpyrrolo[2,3-b]pyridin-5-yl]-1-[(2-methylpropan-2-yl)oxy]propan-2-one |
| SMILES | [C-]#[N+]CCCn1c(C)c(C)c2c(-c3ccc(Cl)cc3)c([C@H](OC(C)(C)C)C(C)=O)c(C)nc21 |
| InChI | InChI=1S/C27H32ClN3O2/c1-16-18(3)31(15-9-14-29-8)26-22(16)24(20-10-12-21(28)13-11-20)23(17(2)30-26)25(19(4)32)33-27(5,6)7/h10-13,25H,9,14-15H2,1-7H3/t25-/m1/s1 |
| InChIKey | RGTNBIYYMULNCC-RUZDIDTESA-N |
| XLogP | 7.04 |
| TPSA | 48.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|