C13H16F4O5S2 — CID 157133180
2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;thiophene 1,1-dioxide (PubChem CID 157133180) has the molecular formula C13H16F4O5S2 and a molecular weight of 392.39 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;thiophene 1,1-dioxide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;thiophene 1,1-dioxide |
|---|---|
| PubChem CID | 157133180 |
| Molecular Formula | C13H16F4O5S2 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;thiophene 1,1-dioxide |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C1CC2CCC1C2.O=S1(=O)C=CC=C1 |
| InChI | InChI=1S/C9H12F4O3S.C4H4O2S/c10-8(11,9(12,13)17(14,15)16)7-4-5-1-2-6(7)3-5;5-7(6)3-1-2-4-7/h5-7H,1-4H2,(H,14,15,16);1-4H |
| InChIKey | AJHRRYOICLPZKR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|