C8H17NO2 — CID 157133693
(3R,4R)-4-hydroxy-3-(propan-2-ylamino)pentan-2-one (PubChem CID 157133693) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (3R,4R)-4-hydroxy-3-(propan-2-ylamino)pentan-2-one.
| Compound Name | (3R,4R)-4-hydroxy-3-(propan-2-ylamino)pentan-2-one |
|---|---|
| PubChem CID | 157133693 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (3R,4R)-4-hydroxy-3-(propan-2-ylamino)pentan-2-one |
| SMILES | CC(=O)[C@H](NC(C)C)[C@@H](C)O |
| InChI | InChI=1S/C8H17NO2/c1-5(2)9-8(6(3)10)7(4)11/h5-6,8-10H,1-4H3/t6-,8-/m1/s1 |
| InChIKey | UBMVEGRUFGWNFJ-HTRCEHHLSA-N |
| XLogP | 0.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |