C27H31BN2 — CID 157133878
4,5,8,10,11,12,14,17,18-nonamethyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaene (PubChem CID 157133878) has the molecular formula C27H31BN2 and a molecular weight of 394.37 g/mol. Its IUPAC name is 4,5,8,10,11,12,14,17,18-nonamethyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaene.
| Compound Name | 4,5,8,10,11,12,14,17,18-nonamethyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 157133878 |
| Molecular Formula | C27H31BN2 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 4,5,8,10,11,12,14,17,18-nonamethyl-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaene |
| SMILES | Cc1cc2c(cc1C)N(C)c1c(C)c(C)c(C)c3c1B2c1cc(C)c(C)cc1N3C |
| InChI | InChI=1S/C27H31BN2/c1-14-10-21-23(12-16(14)3)29(8)26-19(6)18(5)20(7)27-25(26)28(21)22-11-15(2)17(4)13-24(22)30(27)9/h10-13H,1-9H3 |
| InChIKey | QWJRVKUBNGITHB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|