About methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole
methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole (PubChem CID 157134323) has the molecular formula C8H18N2O4S
and a molecular weight of 238.31 g/mol. Its IUPAC name is methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole.
Molecular Properties
| Compound Name | methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole |
| PubChem CID | 157134323 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole |
| SMILES | CCCN1C=CN(C)C1.COS(=O)(=O)O |
| InChI | InChI=1S/C7H14N2.CH4O4S/c1-3-4-9-6-5-8(2)7-9;1-5-6(2,3)4/h5-6H,3-4,7H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | AJLFGBLVBDOTBH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole?
The IUPAC name of methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole (CID 157134323) is methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole.
What is the SMILES notation for methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole?
The canonical SMILES for methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole is CCCN1C=CN(C)C1.COS(=O)(=O)O.
What is the InChIKey of methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole?
The InChIKey is AJLFGBLVBDOTBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.CH4O4S/c1-3-4-9-6-5-8(2)7-9;1-5-6(2,3)4/h5-6H,3-4,7H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole?
methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole has a molecular weight of 238.31 g/mol, XLogP of 0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl hydrogen sulfate;1-methyl-3-propyl-2H-imidazole is sourced from PubChem (CID 157134323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).