About 2-methanidylpropane;sulfane;tungsten
2-methanidylpropane;sulfane;tungsten (PubChem CID 157134336) has the molecular formula C4H11SW-
and a molecular weight of 275.04 g/mol. Its IUPAC name is 2-methanidylpropane;sulfane;tungsten.
Molecular Properties
| Compound Name | 2-methanidylpropane;sulfane;tungsten |
| PubChem CID | 157134336 |
| Molecular Formula | C4H11SW- |
| Molecular Weight | 275.04 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 2-methanidylpropane;sulfane;tungsten |
| SMILES | S.[CH2-]C(C)C.[W] |
| InChI | InChI=1S/C4H9.H2S.W/c1-4(2)3;;/h4H,1H2,2-3H3;1H2;/q-1;; |
| InChIKey | SAQAYTVSDLBTEY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.04 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidylpropane;sulfane;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidylpropane;sulfane;tungsten?
The IUPAC name of 2-methanidylpropane;sulfane;tungsten (CID 157134336) is 2-methanidylpropane;sulfane;tungsten.
What is the SMILES notation for 2-methanidylpropane;sulfane;tungsten?
The canonical SMILES for 2-methanidylpropane;sulfane;tungsten is S.[CH2-]C(C)C.[W].
What is the InChIKey of 2-methanidylpropane;sulfane;tungsten?
The InChIKey is SAQAYTVSDLBTEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.H2S.W/c1-4(2)3;;/h4H,1H2,2-3H3;1H2;/q-1;;.
What are the key properties of 2-methanidylpropane;sulfane;tungsten?
2-methanidylpropane;sulfane;tungsten has a molecular weight of 275.04 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidylpropane;sulfane;tungsten is sourced from PubChem (CID 157134336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).