About [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol
[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol (PubChem CID 15713442) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol.
Molecular Properties
| Compound Name | [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol |
| PubChem CID | 15713442 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol |
| SMILES | OCC1[C@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C6H11NO/c8-3-6-4-1-7-2-5(4)6/h4-8H,1-3H2/t4-,5+,6? |
| InChIKey | YGYOQZPGFXHQMW-XEAPYIEGSA-N |
| XLogP | -0.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol?
The IUPAC name of [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol (CID 15713442) is [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol.
What is the SMILES notation for [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol?
The canonical SMILES for [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol is OCC1[C@H]2CNC[C@@H]12.
What is the InChIKey of [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol?
The InChIKey is YGYOQZPGFXHQMW-XEAPYIEGSA-N. The full InChI is InChI=1S/C6H11NO/c8-3-6-4-1-7-2-5(4)6/h4-8H,1-3H2/t4-,5+,6?.
What are the key properties of [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol?
[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol has a molecular weight of 113.16 g/mol, XLogP of -0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol is sourced from PubChem (CID 15713442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).