About methylaminomethanetriol;trihydroxy(methoxy)silane
methylaminomethanetriol;trihydroxy(methoxy)silane (PubChem CID 157134781) has the molecular formula C3H13NO7Si
and a molecular weight of 203.22 g/mol. Its IUPAC name is methylaminomethanetriol;trihydroxy(methoxy)silane.
Molecular Properties
| Compound Name | methylaminomethanetriol;trihydroxy(methoxy)silane |
| PubChem CID | 157134781 |
| Molecular Formula | C3H13NO7Si |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | methylaminomethanetriol;trihydroxy(methoxy)silane |
| SMILES | CNC(O)(O)O.CO[Si](O)(O)O |
| InChI | InChI=1S/C2H7NO3.CH6O4Si/c1-3-2(4,5)6;1-5-6(2,3)4/h3-6H,1H3;2-4H,1H3 |
| InChIKey | AJMOJIDCWDSLOU-UHFFFAOYSA-N |
| XLogP | -4.16 |
| TPSA | 142.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methylaminomethanetriol;trihydroxy(methoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylaminomethanetriol;trihydroxy(methoxy)silane?
The IUPAC name of methylaminomethanetriol;trihydroxy(methoxy)silane (CID 157134781) is methylaminomethanetriol;trihydroxy(methoxy)silane.
What is the SMILES notation for methylaminomethanetriol;trihydroxy(methoxy)silane?
The canonical SMILES for methylaminomethanetriol;trihydroxy(methoxy)silane is CNC(O)(O)O.CO[Si](O)(O)O.
What is the InChIKey of methylaminomethanetriol;trihydroxy(methoxy)silane?
The InChIKey is AJMOJIDCWDSLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NO3.CH6O4Si/c1-3-2(4,5)6;1-5-6(2,3)4/h3-6H,1H3;2-4H,1H3.
What are the key properties of methylaminomethanetriol;trihydroxy(methoxy)silane?
methylaminomethanetriol;trihydroxy(methoxy)silane has a molecular weight of 203.22 g/mol, XLogP of -4.16, 2 rotatable bonds, 7 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methylaminomethanetriol;trihydroxy(methoxy)silane is sourced from PubChem (CID 157134781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).