C18H24N5O3+ — CID 157134829
1-[7-(cyanomethyl)-2-oxa-4-azoniaspiro[3.5]nonan-7-yl]-3-(2-cyclopropyl-2-oxoethyl)pyrazole-4-carboxamide (PubChem CID 157134829) has the molecular formula C18H24N5O3+ and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-[7-(cyanomethyl)-2-oxa-4-azoniaspiro[3.5]nonan-7-yl]-3-(2-cyclopropyl-2-oxoethyl)pyrazole-4-carboxamide.
| Compound Name | 1-[7-(cyanomethyl)-2-oxa-4-azoniaspiro[3.5]nonan-7-yl]-3-(2-cyclopropyl-2-oxoethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 157134829 |
| Molecular Formula | C18H24N5O3+ |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-[7-(cyanomethyl)-2-oxa-4-azoniaspiro[3.5]nonan-7-yl]-3-(2-cyclopropyl-2-oxoethyl)pyrazole-4-carboxamide |
| SMILES | N#CCC1(n2cc(C(N)=O)c(CC(=O)C3CC3)n2)CC[N+]2(CC1)COC2 |
| InChI | InChI=1S/C18H23N5O3/c19-6-3-18(4-7-23(8-5-18)11-26-12-23)22-10-14(17(20)25)15(21-22)9-16(24)13-1-2-13/h10,13H,1-5,7-9,11-12H2,(H-,20,25)/p+1 |
| InChIKey | QCEBSZVVMTWIKY-UHFFFAOYSA-O |
| XLogP | 0.67 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|