C10H10N2O5 — CID 157134847
3-(hydroxymethyl)pyrrole-2,5-dione;3-methylpyrrole-2,5-dione (PubChem CID 157134847) has the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. Its IUPAC name is 3-(hydroxymethyl)pyrrole-2,5-dione;3-methylpyrrole-2,5-dione.
| Compound Name | 3-(hydroxymethyl)pyrrole-2,5-dione;3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 157134847 |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 3-(hydroxymethyl)pyrrole-2,5-dione;3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)NC1=O.O=C1C=C(CO)C(=O)N1 |
| InChI | InChI=1S/C5H5NO3.C5H5NO2/c7-2-3-1-4(8)6-5(3)9;1-3-2-4(7)6-5(3)8/h1,7H,2H2,(H,6,8,9);2H,1H3,(H,6,7,8) |
| InChIKey | AJMSMDIJROUUIF-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|