C32H41F2N5OSi — CID 157135390
1-[(1S,3R)-3-(butylamino)-6,8-difluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one (PubChem CID 157135390) has the molecular formula C32H41F2N5OSi and a molecular weight of 577.80 g/mol. Its IUPAC name is 1-[(1S,3R)-3-(butylamino)-6,8-difluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one.
| Compound Name | 1-[(1S,3R)-3-(butylamino)-6,8-difluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one |
|---|---|
| PubChem CID | 157135390 |
| Molecular Formula | C32H41F2N5OSi |
| Molecular Weight | 577.80 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | 1-[(1S,3R)-3-(butylamino)-6,8-difluoro-1-[4-(4-methylpiperazin-1-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-trimethylsilylprop-2-yn-1-one |
| SMILES | CCCCN[C@H]1Cc2c([nH]c3c(F)cc(F)cc23)[C@H](c2ccc(N3CCN(C)CC3)cc2)N1C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C32H41F2N5OSi/c1-6-7-13-35-28-21-26-25-19-23(33)20-27(34)30(25)36-31(26)32(39(28)29(40)12-18-41(3,4)5)22-8-10-24(11-9-22)38-16-14-37(2)15-17-38/h8-11,19-20,28,32,35-36H,6-7,13-17,21H2,1-5H3/t28-,32+/m1/s1 |
| InChIKey | AJOGWFVIJNYOJK-NSJVFKKDSA-N |
| XLogP | 5.27 |
| TPSA | 54.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.80 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|