C30H23N4O4S2+ — CID 157136042
3-[2-[(E,3Z)-1,3-dicyano-3-[3-(2-formyloxyethyl)-5-methyl-1,3-benzothiazol-2-ylidene]prop-1-enyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]propanoic acid (PubChem CID 157136042) has the molecular formula C30H23N4O4S2+ and a molecular weight of 567.67 g/mol. Its IUPAC name is 3-[2-[(E,3Z)-1,3-dicyano-3-[3-(2-formyloxyethyl)-5-methyl-1,3-benzothiazol-2-ylidene]prop-1-enyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]propanoic acid.
| Compound Name | 3-[2-[(E,3Z)-1,3-dicyano-3-[3-(2-formyloxyethyl)-5-methyl-1,3-benzothiazol-2-ylidene]prop-1-enyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]propanoic acid |
|---|---|
| PubChem CID | 157136042 |
| Molecular Formula | C30H23N4O4S2+ |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 3-[2-[(E,3Z)-1,3-dicyano-3-[3-(2-formyloxyethyl)-5-methyl-1,3-benzothiazol-2-ylidene]prop-1-enyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]propanoic acid |
| SMILES | Cc1ccc2c(c1)N(CCOC=O)/C(=C(C#N)\C=C(/C#N)c1sc3c4ccccc4ccc3[n+]1CCC(=O)O)S2 |
| InChI | InChI=1S/C30H22N4O4S2/c1-19-6-9-26-25(14-19)34(12-13-38-18-35)29(39-26)21(16-31)15-22(17-32)30-33(11-10-27(36)37)24-8-7-20-4-2-3-5-23(20)28(24)40-30/h2-9,14-15,18H,10-13H2,1H3/p+1 |
| InChIKey | BBQLDFOKVBGFFF-UHFFFAOYSA-O |
| XLogP | 5.55 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|