About alumane;trimethylphosphane
alumane;trimethylphosphane (PubChem CID 157136198) has the molecular formula C3H12AlP
and a molecular weight of 106.08 g/mol. Its IUPAC name is alumane;trimethylphosphane.
Molecular Properties
| Compound Name | alumane;trimethylphosphane |
| PubChem CID | 157136198 |
| Molecular Formula | C3H12AlP |
| Molecular Weight | 106.08 g/mol |
| Exact Mass | 106.05 |
| IUPAC Name | alumane;trimethylphosphane |
| SMILES | CP(C)C.[AlH3] |
| InChI | InChI=1S/C3H9P.Al.3H/c1-4(2)3;;;;/h1-3H3;;;; |
| InChIKey | AJQNWMHRVPMJJB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.08 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze alumane;trimethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;trimethylphosphane?
The IUPAC name of alumane;trimethylphosphane (CID 157136198) is alumane;trimethylphosphane.
What is the SMILES notation for alumane;trimethylphosphane?
The canonical SMILES for alumane;trimethylphosphane is CP(C)C.[AlH3].
What is the InChIKey of alumane;trimethylphosphane?
The InChIKey is AJQNWMHRVPMJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9P.Al.3H/c1-4(2)3;;;;/h1-3H3;;;;.
What are the key properties of alumane;trimethylphosphane?
alumane;trimethylphosphane has a molecular weight of 106.08 g/mol, XLogP of 0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;trimethylphosphane is sourced from PubChem (CID 157136198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).