C25H28FN5O2S — CID 157136215
4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-fluoro-2-pyridinyl]-2-methylbut-3-yn-2-ol (PubChem CID 157136215) has the molecular formula C25H28FN5O2S and a molecular weight of 481.60 g/mol. Its IUPAC name is 4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-fluoro-2-pyridinyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-fluoro-2-pyridinyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 157136215 |
| Molecular Formula | C25H28FN5O2S |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-fluoro-2-pyridinyl]-2-methylbut-3-yn-2-ol |
| SMILES | CN1CCC(c2ncc(-c3cnc(N)c(OCc4cc(C#CC(C)(C)O)ncc4F)c3)s2)CC1 |
| InChI | InChI=1S/C25H28FN5O2S/c1-25(2,32)7-4-19-10-18(20(26)13-28-19)15-33-21-11-17(12-29-23(21)27)22-14-30-24(34-22)16-5-8-31(3)9-6-16/h10-14,16,32H,5-6,8-9,15H2,1-3H3,(H2,27,29) |
| InChIKey | KSJHEEFAJDSRIN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|