C26H31N5O3S — CID 157136218
4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-methoxy-2-pyridinyl]-2-methylbut-3-yn-2-ol (PubChem CID 157136218) has the molecular formula C26H31N5O3S and a molecular weight of 493.63 g/mol. Its IUPAC name is 4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-methoxy-2-pyridinyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-methoxy-2-pyridinyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 157136218 |
| Molecular Formula | C26H31N5O3S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 4-[4-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-5-methoxy-2-pyridinyl]-2-methylbut-3-yn-2-ol |
| SMILES | COc1cnc(C#CC(C)(C)O)cc1COc1cc(-c2cnc(C3CCN(C)CC3)s2)cnc1N |
| InChI | InChI=1S/C26H31N5O3S/c1-26(2,32)8-5-20-11-19(22(33-4)14-28-20)16-34-21-12-18(13-29-24(21)27)23-15-30-25(35-23)17-6-9-31(3)10-7-17/h11-15,17,32H,6-7,9-10,16H2,1-4H3,(H2,27,29) |
| InChIKey | FVVCPMFJMQXOBN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|