About azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine
azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine (PubChem CID 157136653) has the molecular formula C12H14BrN6O4-
and a molecular weight of 386.19 g/mol. Its IUPAC name is azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine.
Molecular Properties
| Compound Name | azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine |
| PubChem CID | 157136653 |
| Molecular Formula | C12H14BrN6O4- |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine |
| SMILES | NCCc1ccc([N+](=O)[O-])nc1.O=[N+]([O-])c1ccc(Br)cn1.[NH2-] |
| InChI | InChI=1S/C7H9N3O2.C5H3BrN2O2.H2N/c8-4-3-6-1-2-7(9-5-6)10(11)12;6-4-1-2-5(7-3-4)8(9)10;/h1-2,5H,3-4,8H2;1-3H;1H2/q;;-1 |
| InChIKey | OPOWSKDBTJQFCR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 171.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine?
The IUPAC name of azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine (CID 157136653) is azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine.
What is the SMILES notation for azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine?
The canonical SMILES for azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine is NCCc1ccc([N+](=O)[O-])nc1.O=[N+]([O-])c1ccc(Br)cn1.[NH2-].
What is the InChIKey of azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine?
The InChIKey is OPOWSKDBTJQFCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2.C5H3BrN2O2.H2N/c8-4-3-6-1-2-7(9-5-6)10(11)12;6-4-1-2-5(7-3-4)8(9)10;/h1-2,5H,3-4,8H2;1-3H;1H2/q;;-1.
What are the key properties of azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine?
azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine has a molecular weight of 386.19 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;5-bromo-2-nitropyridine;2-(6-nitro-3-pyridinyl)ethanamine is sourced from PubChem (CID 157136653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).