C12H12F5N3O — CID 157136722
5-fluoro-6-[(4R,5R,6S)-5-fluoro-2,4-dimethyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]pyridin-2-amine (PubChem CID 157136722) has the molecular formula C12H12F5N3O and a molecular weight of 309.24 g/mol. Its IUPAC name is 5-fluoro-6-[(4R,5R,6S)-5-fluoro-2,4-dimethyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]pyridin-2-amine.
| Compound Name | 5-fluoro-6-[(4R,5R,6S)-5-fluoro-2,4-dimethyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 157136722 |
| Molecular Formula | C12H12F5N3O |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 5-fluoro-6-[(4R,5R,6S)-5-fluoro-2,4-dimethyl-6-(trifluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]pyridin-2-amine |
| SMILES | CC1=N[C@](C)(c2nc(N)ccc2F)[C@@H](F)[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C12H12F5N3O/c1-5-20-11(2,8(14)10(21-5)12(15,16)17)9-6(13)3-4-7(18)19-9/h3-4,8,10H,1-2H3,(H2,18,19)/t8-,10-,11-/m0/s1 |
| InChIKey | AJSCRLNLBFYRGB-LSJOCFKGSA-N |
| XLogP | 2.74 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |