C16H26 — CID 157136977
1-ethenyl-4-octa-1,3,5,7-tetraynylbenzene;molecular hydrogen (PubChem CID 157136977) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 1-ethenyl-4-octa-1,3,5,7-tetraynylbenzene;molecular hydrogen.
| Compound Name | 1-ethenyl-4-octa-1,3,5,7-tetraynylbenzene;molecular hydrogen |
|---|---|
| PubChem CID | 157136977 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1-ethenyl-4-octa-1,3,5,7-tetraynylbenzene;molecular hydrogen |
| SMILES | C#CC#CC#CC#Cc1ccc(C=C)cc1.[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C16H8.9H2/c1-3-5-6-7-8-9-10-16-13-11-15(4-2)12-14-16;;;;;;;;;/h1,4,11-14H,2H2;9*1H |
| InChIKey | AJSSWLSWFJRPBQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|