C39H44FN9O2 — CID 157137079
(E)-5-(dimethylamino)-1-[3-[3-(3-fluoro-4-morpholin-4-ylanilino)-6-(3-piperidin-1-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]pent-3-en-2-one (PubChem CID 157137079) has the molecular formula C39H44FN9O2 and a molecular weight of 689.84 g/mol. Its IUPAC name is (E)-5-(dimethylamino)-1-[3-[3-(3-fluoro-4-morpholin-4-ylanilino)-6-(3-piperidin-1-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]pent-3-en-2-one.
| Compound Name | (E)-5-(dimethylamino)-1-[3-[3-(3-fluoro-4-morpholin-4-ylanilino)-6-(3-piperidin-1-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]pent-3-en-2-one |
|---|---|
| PubChem CID | 157137079 |
| Molecular Formula | C39H44FN9O2 |
| Molecular Weight | 689.84 g/mol |
| Exact Mass | 689.36 |
| IUPAC Name | (E)-5-(dimethylamino)-1-[3-[3-(3-fluoro-4-morpholin-4-ylanilino)-6-(3-piperidin-1-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]pent-3-en-2-one |
| SMILES | CN(C)C/C=C/C(=O)Cc1cccc(-c2nc(Nc3cccc(N4CCCCC4)c3)nc3n[nH]c(Nc4ccc(N5CCOCC5)c(F)c4)c23)c1 |
| InChI | InChI=1S/C39H44FN9O2/c1-47(2)16-8-13-32(50)24-27-9-6-10-28(23-27)36-35-37(41-30-14-15-34(33(40)26-30)49-19-21-51-22-20-49)45-46-38(35)44-39(43-36)42-29-11-7-12-31(25-29)48-17-4-3-5-18-48/h6-15,23,25-26H,3-5,16-22,24H2,1-2H3,(H3,41,42,43,44,45,46)/b13-8+ |
| InChIKey | XMSOKSRMBNFUHH-MDWZMJQESA-N |
| XLogP | 6.70 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.84 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|