C29H35N5O2S — CID 157137389
3-[(1R,2S)-1-benzyl-7-[3-[(1-methyltriazol-4-yl)sulfonylmethyl]azetidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-azabicyclo[3.1.0]hexane (PubChem CID 157137389) has the molecular formula C29H35N5O2S and a molecular weight of 517.70 g/mol. Its IUPAC name is 3-[(1R,2S)-1-benzyl-7-[3-[(1-methyltriazol-4-yl)sulfonylmethyl]azetidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-[(1R,2S)-1-benzyl-7-[3-[(1-methyltriazol-4-yl)sulfonylmethyl]azetidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 157137389 |
| Molecular Formula | C29H35N5O2S |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 3-[(1R,2S)-1-benzyl-7-[3-[(1-methyltriazol-4-yl)sulfonylmethyl]azetidin-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-azabicyclo[3.1.0]hexane |
| SMILES | Cn1cc(S(=O)(=O)CC2CN(c3ccc4c(c3)[C@@H](Cc3ccccc3)[C@@H](N3CC5CC5C3)CC4)C2)nn1 |
| InChI | InChI=1S/C29H35N5O2S/c1-32-18-29(30-31-32)37(35,36)19-21-14-33(15-21)25-9-7-22-8-10-28(34-16-23-12-24(23)17-34)27(26(22)13-25)11-20-5-3-2-4-6-20/h2-7,9,13,18,21,23-24,27-28H,8,10-12,14-17,19H2,1H3/t23?,24?,27-,28+/m1/s1 |
| InChIKey | AJTXJOJBSMCBFU-KXOSSASBSA-N |
| XLogP | 3.32 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |